C14H18N2O4S — CID 20954795
1'-ethylsulfonylspiro[3H-1,3-benzoxazine-2,4'-piperidine]-4-one (PubChem CID 20954795) has the molecular formula C14H18N2O4S and a molecular weight of 310.37 g/mol. Its IUPAC name is 1'-ethylsulfonylspiro[3H-1,3-benzoxazine-2,4'-piperidine]-4-one.
| Compound Name | 1'-ethylsulfonylspiro[3H-1,3-benzoxazine-2,4'-piperidine]-4-one |
|---|---|
| PubChem CID | 20954795 |
| Molecular Formula | C14H18N2O4S |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 1'-ethylsulfonylspiro[3H-1,3-benzoxazine-2,4'-piperidine]-4-one |
| SMILES | CCS(=O)(=O)N1CCC2(CC1)NC(=O)c1ccccc1O2 |
| InChI | InChI=1S/C14H18N2O4S/c1-2-21(18,19)16-9-7-14(8-10-16)15-13(17)11-5-3-4-6-12(11)20-14/h3-6H,2,7-10H2,1H3,(H,15,17) |
| InChIKey | HLURPVGUHUIUJJ-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |