C14H19N2O2+ — CID 6925492
1'-ethylspiro[3H-1,3-benzoxazine-2,4'-piperidin-1-ium]-4-one (PubChem CID 6925492) has the molecular formula C14H19N2O2+ and a molecular weight of 247.32 g/mol. Its IUPAC name is 1'-ethylspiro[3H-1,3-benzoxazine-2,4'-piperidin-1-ium]-4-one.
| Compound Name | 1'-ethylspiro[3H-1,3-benzoxazine-2,4'-piperidin-1-ium]-4-one |
|---|---|
| PubChem CID | 6925492 |
| Molecular Formula | C14H19N2O2+ |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | 1'-ethylspiro[3H-1,3-benzoxazine-2,4'-piperidin-1-ium]-4-one |
| SMILES | CC[NH+]1CCC2(CC1)NC(=O)c1ccccc1O2 |
| InChI | InChI=1S/C14H18N2O2/c1-2-16-9-7-14(8-10-16)15-13(17)11-5-3-4-6-12(11)18-14/h3-6H,2,7-10H2,1H3,(H,15,17)/p+1 |
| InChIKey | CNRRVOZJQGQCND-UHFFFAOYSA-O |
| XLogP | 0.20 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |