methyl 2-(2-oxo-1,3-dithiol-4-yl)benzoate

C11H8O3S2 — CID 11021386

IUPACmethyl 2-(2-oxo-1,3-dithiol-4-yl)benzoate
SMILESCOC(=O)c1ccccc1-c1csc(=O)s1
InChIInChI=1S/C11H8O3S2/c1-14-10(12)8-5-3-2-4-7(8)9-6-15-11(13)16-9/h2-6H,1H3
InChIKeyHPVBQCSFQALPNG-UHFFFAOYSA-N
MW252.32 g/mol
LogP2.62
Rot. Bonds2

About methyl 2-(2-oxo-1,3-dithiol-4-yl)benzoate

methyl 2-(2-oxo-1,3-dithiol-4-yl)benzoate (PubChem CID 11021386) has the molecular formula C11H8O3S2 and a molecular weight of 252.32 g/mol. Its IUPAC name is methyl 2-(2-oxo-1,3-dithiol-4-yl)benzoate.

Molecular Properties

Compound Namemethyl 2-(2-oxo-1,3-dithiol-4-yl)benzoate
PubChem CID11021386
Molecular FormulaC11H8O3S2
Molecular Weight252.32 g/mol
Exact Mass251.99
IUPAC Namemethyl 2-(2-oxo-1,3-dithiol-4-yl)benzoate
SMILESCOC(=O)c1ccccc1-c1csc(=O)s1
InChIInChI=1S/C11H8O3S2/c1-14-10(12)8-5-3-2-4-7(8)9-6-15-11(13)16-9/h2-6H,1H3
InChIKeyHPVBQCSFQALPNG-UHFFFAOYSA-N
XLogP2.62
TPSA43.37 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500252.32
LogP ≤ 52.62
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 2-(2-oxo-1,3-dithiol-4-yl)benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(2-oxo-1,3-dithiol-4-yl)benzoate?
The IUPAC name of methyl 2-(2-oxo-1,3-dithiol-4-yl)benzoate (CID 11021386) is methyl 2-(2-oxo-1,3-dithiol-4-yl)benzoate.
What is the SMILES notation for methyl 2-(2-oxo-1,3-dithiol-4-yl)benzoate?
The canonical SMILES for methyl 2-(2-oxo-1,3-dithiol-4-yl)benzoate is COC(=O)c1ccccc1-c1csc(=O)s1.
What is the InChIKey of methyl 2-(2-oxo-1,3-dithiol-4-yl)benzoate?
The InChIKey is HPVBQCSFQALPNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8O3S2/c1-14-10(12)8-5-3-2-4-7(8)9-6-15-11(13)16-9/h2-6H,1H3.
What are the key properties of methyl 2-(2-oxo-1,3-dithiol-4-yl)benzoate?
methyl 2-(2-oxo-1,3-dithiol-4-yl)benzoate has a molecular weight of 252.32 g/mol, XLogP of 2.62, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(2-oxo-1,3-dithiol-4-yl)benzoate is sourced from PubChem (CID 11021386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).