C17H17N5OS — CID 110220030
1-(5-pyrazin-2-yl-4-thiophen-2-ylpyrimidin-2-yl)piperidin-3-ol (PubChem CID 110220030) has the molecular formula C17H17N5OS and a molecular weight of 339.42 g/mol. Its IUPAC name is 1-(5-pyrazin-2-yl-4-thiophen-2-ylpyrimidin-2-yl)piperidin-3-ol.
| Compound Name | 1-(5-pyrazin-2-yl-4-thiophen-2-ylpyrimidin-2-yl)piperidin-3-ol |
|---|---|
| PubChem CID | 110220030 |
| Molecular Formula | C17H17N5OS |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | 1-(5-pyrazin-2-yl-4-thiophen-2-ylpyrimidin-2-yl)piperidin-3-ol |
| SMILES | OC1CCCN(c2ncc(-c3cnccn3)c(-c3cccs3)n2)C1 |
| InChI | InChI=1S/C17H17N5OS/c23-12-3-1-7-22(11-12)17-20-9-13(14-10-18-5-6-19-14)16(21-17)15-4-2-8-24-15/h2,4-6,8-10,12,23H,1,3,7,11H2 |
| InChIKey | MTHICLMWGPBYJP-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 75.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |