C18H21N5S — CID 110220898
5-(1-methylimidazol-2-yl)-2-(3-methylpiperidin-1-yl)-4-thiophen-2-ylpyrimidine (PubChem CID 110220898) has the molecular formula C18H21N5S and a molecular weight of 339.47 g/mol. Its IUPAC name is 5-(1-methylimidazol-2-yl)-2-(3-methylpiperidin-1-yl)-4-thiophen-2-ylpyrimidine.
| Compound Name | 5-(1-methylimidazol-2-yl)-2-(3-methylpiperidin-1-yl)-4-thiophen-2-ylpyrimidine |
|---|---|
| PubChem CID | 110220898 |
| Molecular Formula | C18H21N5S |
| Molecular Weight | 339.47 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | 5-(1-methylimidazol-2-yl)-2-(3-methylpiperidin-1-yl)-4-thiophen-2-ylpyrimidine |
| SMILES | CC1CCCN(c2ncc(-c3nccn3C)c(-c3cccs3)n2)C1 |
| InChI | InChI=1S/C18H21N5S/c1-13-5-3-8-23(12-13)18-20-11-14(17-19-7-9-22(17)2)16(21-18)15-6-4-10-24-15/h4,6-7,9-11,13H,3,5,8,12H2,1-2H3 |
| InChIKey | LDIHNPQLGFOIRF-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.47 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |