C23H28N6S — CID 98057828
(1S,9S)-5-[(3S)-3-methylpiperidin-1-yl]-12-[(5-thiophen-2-yl-1H-pyrazol-4-yl)methyl]-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene (PubChem CID 98057828) has the molecular formula C23H28N6S and a molecular weight of 420.59 g/mol. Its IUPAC name is (1S,9S)-5-[(3S)-3-methylpiperidin-1-yl]-12-[(5-thiophen-2-yl-1H-pyrazol-4-yl)methyl]-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene.
| Compound Name | (1S,9S)-5-[(3S)-3-methylpiperidin-1-yl]-12-[(5-thiophen-2-yl-1H-pyrazol-4-yl)methyl]-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene |
|---|---|
| PubChem CID | 98057828 |
| Molecular Formula | C23H28N6S |
| Molecular Weight | 420.59 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | (1S,9S)-5-[(3S)-3-methylpiperidin-1-yl]-12-[(5-thiophen-2-yl-1H-pyrazol-4-yl)methyl]-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene |
| SMILES | C[C@H]1CCCN(c2ncc3c(n2)C[C@@H]2CC[C@@H]3N2Cc2cn[nH]c2-c2cccs2)C1 |
| InChI | InChI=1S/C23H28N6S/c1-15-4-2-8-28(13-15)23-24-12-18-19(26-23)10-17-6-7-20(18)29(17)14-16-11-25-27-22(16)21-5-3-9-30-21/h3,5,9,11-12,15,17,20H,2,4,6-8,10,13-14H2,1H3,(H,25,27)/t15-,17-,20-/m0/s1 |
| InChIKey | KZKYITWOYZZNBD-KNBMTAEXSA-N |
| XLogP | 4.43 |
| TPSA | 60.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.59 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |