C20H24N4O2 — CID 98058727
2-[[(1R,9R)-5-morpholin-4-yl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl]methyl]phenol (PubChem CID 98058727) has the molecular formula C20H24N4O2 and a molecular weight of 352.44 g/mol. Its IUPAC name is 2-[[(1R,9R)-5-morpholin-4-yl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl]methyl]phenol.
| Compound Name | 2-[[(1R,9R)-5-morpholin-4-yl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl]methyl]phenol |
|---|---|
| PubChem CID | 98058727 |
| Molecular Formula | C20H24N4O2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | 2-[[(1R,9R)-5-morpholin-4-yl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl]methyl]phenol |
| SMILES | Oc1ccccc1CN1[C@@H]2CC[C@@H]1c1cnc(N3CCOCC3)nc1C2 |
| InChI | InChI=1S/C20H24N4O2/c25-19-4-2-1-3-14(19)13-24-15-5-6-18(24)16-12-21-20(22-17(16)11-15)23-7-9-26-10-8-23/h1-4,12,15,18,25H,5-11,13H2/t15-,18-/m1/s1 |
| InChIKey | NTVUYYLINIMMOS-CRAIPNDOSA-N |
| XLogP | 2.28 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|