C22H27ClN4O2 — CID 98136607
4-chloro-2-[[(1R,9R)-5-[(3S)-3-(hydroxymethyl)piperidin-1-yl]-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl]methyl]phenol (PubChem CID 98136607) has the molecular formula C22H27ClN4O2 and a molecular weight of 414.94 g/mol. Its IUPAC name is 4-chloro-2-[[(1R,9R)-5-[(3S)-3-(hydroxymethyl)piperidin-1-yl]-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl]methyl]phenol.
| Compound Name | 4-chloro-2-[[(1R,9R)-5-[(3S)-3-(hydroxymethyl)piperidin-1-yl]-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl]methyl]phenol |
|---|---|
| PubChem CID | 98136607 |
| Molecular Formula | C22H27ClN4O2 |
| Molecular Weight | 414.94 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | 4-chloro-2-[[(1R,9R)-5-[(3S)-3-(hydroxymethyl)piperidin-1-yl]-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl]methyl]phenol |
| SMILES | OC[C@H]1CCCN(c2ncc3c(n2)C[C@H]2CC[C@H]3N2Cc2cc(Cl)ccc2O)C1 |
| InChI | InChI=1S/C22H27ClN4O2/c23-16-3-6-21(29)15(8-16)12-27-17-4-5-20(27)18-10-24-22(25-19(18)9-17)26-7-1-2-14(11-26)13-28/h3,6,8,10,14,17,20,28-29H,1-2,4-5,7,9,11-13H2/t14-,17+,20+/m0/s1 |
| InChIKey | CHSMBKBLMHSVAU-JNAXZKDPSA-N |
| XLogP | 3.31 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.94 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|