C18H26ClN5O2 — CID 143609880
2-[6-(3-aminopiperidin-1-yl)pyrimidin-4-yl]-4-chlorophenol;2-(methylamino)ethanol (PubChem CID 143609880) has the molecular formula C18H26ClN5O2 and a molecular weight of 379.89 g/mol. Its IUPAC name is 2-[6-(3-aminopiperidin-1-yl)pyrimidin-4-yl]-4-chlorophenol;2-(methylamino)ethanol.
| Compound Name | 2-[6-(3-aminopiperidin-1-yl)pyrimidin-4-yl]-4-chlorophenol;2-(methylamino)ethanol |
|---|---|
| PubChem CID | 143609880 |
| Molecular Formula | C18H26ClN5O2 |
| Molecular Weight | 379.89 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | 2-[6-(3-aminopiperidin-1-yl)pyrimidin-4-yl]-4-chlorophenol;2-(methylamino)ethanol |
| SMILES | CNCCO.NC1CCCN(c2cc(-c3cc(Cl)ccc3O)ncn2)C1 |
| InChI | InChI=1S/C15H17ClN4O.C3H9NO/c16-10-3-4-14(21)12(6-10)13-7-15(19-9-18-13)20-5-1-2-11(17)8-20;1-4-2-3-5/h3-4,6-7,9,11,21H,1-2,5,8,17H2;4-5H,2-3H2,1H3 |
| InChIKey | VXVDAFAQFHOBGD-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.89 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |