C23H29FN4O — CID 46950973
12-[(2-fluoro-5-methoxyphenyl)methyl]-5-(3-methylpiperidin-1-yl)-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene (PubChem CID 46950973) has the molecular formula C23H29FN4O and a molecular weight of 396.51 g/mol. Its IUPAC name is 12-[(2-fluoro-5-methoxyphenyl)methyl]-5-(3-methylpiperidin-1-yl)-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene.
| Compound Name | 12-[(2-fluoro-5-methoxyphenyl)methyl]-5-(3-methylpiperidin-1-yl)-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene |
|---|---|
| PubChem CID | 46950973 |
| Molecular Formula | C23H29FN4O |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | 12-[(2-fluoro-5-methoxyphenyl)methyl]-5-(3-methylpiperidin-1-yl)-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene |
| SMILES | COc1ccc(F)c(CN2C3CCC2c2cnc(N4CCCC(C)C4)nc2C3)c1 |
| InChI | InChI=1S/C23H29FN4O/c1-15-4-3-9-27(13-15)23-25-12-19-21(26-23)11-17-5-8-22(19)28(17)14-16-10-18(29-2)6-7-20(16)24/h6-7,10,12,15,17,22H,3-5,8-9,11,13-14H2,1-2H3 |
| InChIKey | JJFATWFYUMAARE-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |