C22H26N4O — CID 110220991
12-[(1-ethyl-5-methoxyindol-3-yl)methyl]-5-methyl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene (PubChem CID 110220991) has the molecular formula C22H26N4O and a molecular weight of 362.48 g/mol. Its IUPAC name is 12-[(1-ethyl-5-methoxyindol-3-yl)methyl]-5-methyl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene.
| Compound Name | 12-[(1-ethyl-5-methoxyindol-3-yl)methyl]-5-methyl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene |
|---|---|
| PubChem CID | 110220991 |
| Molecular Formula | C22H26N4O |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | 12-[(1-ethyl-5-methoxyindol-3-yl)methyl]-5-methyl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene |
| SMILES | CCn1cc(CN2C3CCC2c2cnc(C)nc2C3)c2cc(OC)ccc21 |
| InChI | InChI=1S/C22H26N4O/c1-4-25-12-15(18-10-17(27-3)6-8-21(18)25)13-26-16-5-7-22(26)19-11-23-14(2)24-20(19)9-16/h6,8,10-12,16,22H,4-5,7,9,13H2,1-3H3 |
| InChIKey | PPWNRQKEAYXUQG-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |