C17H20N4 — CID 124796303
(1S,9S)-5-methyl-12-[(6-methyl-2-pyridinyl)methyl]-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene (PubChem CID 124796303) has the molecular formula C17H20N4 and a molecular weight of 280.38 g/mol. Its IUPAC name is (1S,9S)-5-methyl-12-[(6-methyl-2-pyridinyl)methyl]-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene.
| Compound Name | (1S,9S)-5-methyl-12-[(6-methyl-2-pyridinyl)methyl]-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene |
|---|---|
| PubChem CID | 124796303 |
| Molecular Formula | C17H20N4 |
| Molecular Weight | 280.38 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | (1S,9S)-5-methyl-12-[(6-methyl-2-pyridinyl)methyl]-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene |
| SMILES | Cc1cccc(CN2[C@H]3CC[C@H]2c2cnc(C)nc2C3)n1 |
| InChI | InChI=1S/C17H20N4/c1-11-4-3-5-13(19-11)10-21-14-6-7-17(21)15-9-18-12(2)20-16(15)8-14/h3-5,9,14,17H,6-8,10H2,1-2H3/t14-,17-/m0/s1 |
| InChIKey | UEZAULFNVHZXPJ-YOEHRIQHSA-N |
| XLogP | 2.75 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.38 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |