C15H17N3S — CID 92565588
(1R,9S)-5-methyl-12-(thiophen-2-ylmethyl)-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene (PubChem CID 92565588) has the molecular formula C15H17N3S and a molecular weight of 271.39 g/mol. Its IUPAC name is (1R,9S)-5-methyl-12-(thiophen-2-ylmethyl)-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene.
| Compound Name | (1R,9S)-5-methyl-12-(thiophen-2-ylmethyl)-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene |
|---|---|
| PubChem CID | 92565588 |
| Molecular Formula | C15H17N3S |
| Molecular Weight | 271.39 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | (1R,9S)-5-methyl-12-(thiophen-2-ylmethyl)-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene |
| SMILES | Cc1ncc2c(n1)C[C@@H]1CC[C@H]2N1Cc1cccs1 |
| InChI | InChI=1S/C15H17N3S/c1-10-16-8-13-14(17-10)7-11-4-5-15(13)18(11)9-12-3-2-6-19-12/h2-3,6,8,11,15H,4-5,7,9H2,1H3/t11-,15+/m0/s1 |
| InChIKey | KPAFAURTLGKUNJ-XHDPSFHLSA-N |
| XLogP | 3.11 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.39 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |