C17H17Cl2N3 — CID 110220976
12-[(2,3-dichlorophenyl)methyl]-5-methyl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene (PubChem CID 110220976) has the molecular formula C17H17Cl2N3 and a molecular weight of 334.25 g/mol. Its IUPAC name is 12-[(2,3-dichlorophenyl)methyl]-5-methyl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene.
| Compound Name | 12-[(2,3-dichlorophenyl)methyl]-5-methyl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene |
|---|---|
| PubChem CID | 110220976 |
| Molecular Formula | C17H17Cl2N3 |
| Molecular Weight | 334.25 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | 12-[(2,3-dichlorophenyl)methyl]-5-methyl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene |
| SMILES | Cc1ncc2c(n1)CC1CCC2N1Cc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C17H17Cl2N3/c1-10-20-8-13-15(21-10)7-12-5-6-16(13)22(12)9-11-3-2-4-14(18)17(11)19/h2-4,8,12,16H,5-7,9H2,1H3 |
| InChIKey | VCQWNMDJRBTWEZ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.25 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |