C22H23N3O — CID 98071068
(1S,9S)-12-[(2-methoxynaphthalen-1-yl)methyl]-5-methyl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene (PubChem CID 98071068) has the molecular formula C22H23N3O and a molecular weight of 345.45 g/mol. Its IUPAC name is (1S,9S)-12-[(2-methoxynaphthalen-1-yl)methyl]-5-methyl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene.
| Compound Name | (1S,9S)-12-[(2-methoxynaphthalen-1-yl)methyl]-5-methyl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene |
|---|---|
| PubChem CID | 98071068 |
| Molecular Formula | C22H23N3O |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | (1S,9S)-12-[(2-methoxynaphthalen-1-yl)methyl]-5-methyl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene |
| SMILES | COc1ccc2ccccc2c1CN1[C@H]2CC[C@H]1c1cnc(C)nc1C2 |
| InChI | InChI=1S/C22H23N3O/c1-14-23-12-18-20(24-14)11-16-8-9-21(18)25(16)13-19-17-6-4-3-5-15(17)7-10-22(19)26-2/h3-7,10,12,16,21H,8-9,11,13H2,1-2H3/t16-,21-/m0/s1 |
| InChIKey | OCDHPYUMOFHCFC-KKSFZXQISA-N |
| XLogP | 4.21 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |