C20H20N4 — CID 98071015
(1S,9S)-5-methyl-12-(quinolin-6-ylmethyl)-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene (PubChem CID 98071015) has the molecular formula C20H20N4 and a molecular weight of 316.41 g/mol. Its IUPAC name is (1S,9S)-5-methyl-12-(quinolin-6-ylmethyl)-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene.
| Compound Name | (1S,9S)-5-methyl-12-(quinolin-6-ylmethyl)-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene |
|---|---|
| PubChem CID | 98071015 |
| Molecular Formula | C20H20N4 |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | (1S,9S)-5-methyl-12-(quinolin-6-ylmethyl)-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene |
| SMILES | Cc1ncc2c(n1)C[C@@H]1CC[C@@H]2N1Cc1ccc2ncccc2c1 |
| InChI | InChI=1S/C20H20N4/c1-13-22-11-17-19(23-13)10-16-5-7-20(17)24(16)12-14-4-6-18-15(9-14)3-2-8-21-18/h2-4,6,8-9,11,16,20H,5,7,10,12H2,1H3/t16-,20-/m0/s1 |
| InChIKey | FVUGIGVESJLLPW-JXFKEZNVSA-N |
| XLogP | 3.60 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |