About 6-[(3-tert-butyl-3,6-diazabicyclo[3.1.1]heptan-6-yl)methyl]quinoline
6-[(3-tert-butyl-3,6-diazabicyclo[3.1.1]heptan-6-yl)methyl]quinoline (PubChem CID 134506624) has the molecular formula C19H25N3
and a molecular weight of 295.43 g/mol. Its IUPAC name is 6-[(3-tert-butyl-3,6-diazabicyclo[3.1.1]heptan-6-yl)methyl]quinoline.
Molecular Properties
| Compound Name | 6-[(3-tert-butyl-3,6-diazabicyclo[3.1.1]heptan-6-yl)methyl]quinoline |
| PubChem CID | 134506624 |
| Molecular Formula | C19H25N3 |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.20 |
| IUPAC Name | 6-[(3-tert-butyl-3,6-diazabicyclo[3.1.1]heptan-6-yl)methyl]quinoline |
| SMILES | CC(C)(C)N1CC2CC(C1)N2Cc1ccc2ncccc2c1 |
| InChI | InChI=1S/C19H25N3/c1-19(2,3)21-12-16-10-17(13-21)22(16)11-14-6-7-18-15(9-14)5-4-8-20-18/h4-9,16-17H,10-13H2,1-3H3 |
| InChIKey | OWTUSYZYFZAMHH-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-[(3-tert-butyl-3,6-diazabicyclo[3.1.1]heptan-6-yl)methyl]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(3-tert-butyl-3,6-diazabicyclo[3.1.1]heptan-6-yl)methyl]quinoline?
The IUPAC name of 6-[(3-tert-butyl-3,6-diazabicyclo[3.1.1]heptan-6-yl)methyl]quinoline (CID 134506624) is 6-[(3-tert-butyl-3,6-diazabicyclo[3.1.1]heptan-6-yl)methyl]quinoline.
What is the SMILES notation for 6-[(3-tert-butyl-3,6-diazabicyclo[3.1.1]heptan-6-yl)methyl]quinoline?
The canonical SMILES for 6-[(3-tert-butyl-3,6-diazabicyclo[3.1.1]heptan-6-yl)methyl]quinoline is CC(C)(C)N1CC2CC(C1)N2Cc1ccc2ncccc2c1.
What is the InChIKey of 6-[(3-tert-butyl-3,6-diazabicyclo[3.1.1]heptan-6-yl)methyl]quinoline?
The InChIKey is OWTUSYZYFZAMHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25N3/c1-19(2,3)21-12-16-10-17(13-21)22(16)11-14-6-7-18-15(9-14)5-4-8-20-18/h4-9,16-17H,10-13H2,1-3H3.
What are the key properties of 6-[(3-tert-butyl-3,6-diazabicyclo[3.1.1]heptan-6-yl)methyl]quinoline?
6-[(3-tert-butyl-3,6-diazabicyclo[3.1.1]heptan-6-yl)methyl]quinoline has a molecular weight of 295.43 g/mol, XLogP of 3.29, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(3-tert-butyl-3,6-diazabicyclo[3.1.1]heptan-6-yl)methyl]quinoline is sourced from PubChem (CID 134506624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).