C21H25FN4O — CID 98136734
(1R,9R)-12-[(2-fluoro-4-methoxyphenyl)methyl]-5-pyrrolidin-1-yl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene (PubChem CID 98136734) has the molecular formula C21H25FN4O and a molecular weight of 368.46 g/mol. Its IUPAC name is (1R,9R)-12-[(2-fluoro-4-methoxyphenyl)methyl]-5-pyrrolidin-1-yl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene.
| Compound Name | (1R,9R)-12-[(2-fluoro-4-methoxyphenyl)methyl]-5-pyrrolidin-1-yl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene |
|---|---|
| PubChem CID | 98136734 |
| Molecular Formula | C21H25FN4O |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | (1R,9R)-12-[(2-fluoro-4-methoxyphenyl)methyl]-5-pyrrolidin-1-yl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene |
| SMILES | COc1ccc(CN2[C@@H]3CC[C@@H]2c2cnc(N4CCCC4)nc2C3)c(F)c1 |
| InChI | InChI=1S/C21H25FN4O/c1-27-16-6-4-14(18(22)11-16)13-26-15-5-7-20(26)17-12-23-21(24-19(17)10-15)25-8-2-3-9-25/h4,6,11-12,15,20H,2-3,5,7-10,13H2,1H3/t15-,20-/m1/s1 |
| InChIKey | MNFSXJBLCUCKRA-FOIQADDNSA-N |
| XLogP | 3.49 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |