C18H22N2O4 — CID 110220429
6-(1-acetylpiperidine-4-carbonyl)-2-ethyl-4H-1,4-benzoxazin-3-one (PubChem CID 110220429) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is 6-(1-acetylpiperidine-4-carbonyl)-2-ethyl-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-(1-acetylpiperidine-4-carbonyl)-2-ethyl-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 110220429 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 6-(1-acetylpiperidine-4-carbonyl)-2-ethyl-4H-1,4-benzoxazin-3-one |
| SMILES | CCC1Oc2ccc(C(=O)C3CCN(C(C)=O)CC3)cc2NC1=O |
| InChI | InChI=1S/C18H22N2O4/c1-3-15-18(23)19-14-10-13(4-5-16(14)24-15)17(22)12-6-8-20(9-7-12)11(2)21/h4-5,10,12,15H,3,6-9H2,1-2H3,(H,19,23) |
| InChIKey | MPVUSUYAYXLWAF-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |