C23H24N2O2S — CID 110222143
N-[(6-methoxy-2H-chromen-3-yl)methyl]-1-(5-methyl-2-pyridinyl)-2-thiophen-3-ylethanamine (PubChem CID 110222143) has the molecular formula C23H24N2O2S and a molecular weight of 392.52 g/mol. Its IUPAC name is N-[(6-methoxy-2H-chromen-3-yl)methyl]-1-(5-methyl-2-pyridinyl)-2-thiophen-3-ylethanamine.
| Compound Name | N-[(6-methoxy-2H-chromen-3-yl)methyl]-1-(5-methyl-2-pyridinyl)-2-thiophen-3-ylethanamine |
|---|---|
| PubChem CID | 110222143 |
| Molecular Formula | C23H24N2O2S |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | N-[(6-methoxy-2H-chromen-3-yl)methyl]-1-(5-methyl-2-pyridinyl)-2-thiophen-3-ylethanamine |
| SMILES | COc1ccc2c(c1)C=C(CNC(Cc1ccsc1)c1ccc(C)cn1)CO2 |
| InChI | InChI=1S/C23H24N2O2S/c1-16-3-5-21(24-12-16)22(10-17-7-8-28-15-17)25-13-18-9-19-11-20(26-2)4-6-23(19)27-14-18/h3-9,11-12,15,22,25H,10,13-14H2,1-2H3 |
| InChIKey | DRVOMXXBRYGGPX-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |