C22H22N4S — CID 110222156
1-(5-methyl-2-pyridinyl)-N-[(2-pyrazol-1-ylphenyl)methyl]-2-thiophen-3-ylethanamine (PubChem CID 110222156) has the molecular formula C22H22N4S and a molecular weight of 374.51 g/mol. Its IUPAC name is 1-(5-methyl-2-pyridinyl)-N-[(2-pyrazol-1-ylphenyl)methyl]-2-thiophen-3-ylethanamine.
| Compound Name | 1-(5-methyl-2-pyridinyl)-N-[(2-pyrazol-1-ylphenyl)methyl]-2-thiophen-3-ylethanamine |
|---|---|
| PubChem CID | 110222156 |
| Molecular Formula | C22H22N4S |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | 1-(5-methyl-2-pyridinyl)-N-[(2-pyrazol-1-ylphenyl)methyl]-2-thiophen-3-ylethanamine |
| SMILES | Cc1ccc(C(Cc2ccsc2)NCc2ccccc2-n2cccn2)nc1 |
| InChI | InChI=1S/C22H22N4S/c1-17-7-8-20(23-14-17)21(13-18-9-12-27-16-18)24-15-19-5-2-3-6-22(19)26-11-4-10-25-26/h2-12,14,16,21,24H,13,15H2,1H3 |
| InChIKey | ZYUOIGFZJSZKKK-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |