C22H23N3S — CID 110222149
N-[(1-methylindol-3-yl)methyl]-1-(5-methyl-2-pyridinyl)-2-thiophen-3-ylethanamine (PubChem CID 110222149) has the molecular formula C22H23N3S and a molecular weight of 361.51 g/mol. Its IUPAC name is N-[(1-methylindol-3-yl)methyl]-1-(5-methyl-2-pyridinyl)-2-thiophen-3-ylethanamine.
| Compound Name | N-[(1-methylindol-3-yl)methyl]-1-(5-methyl-2-pyridinyl)-2-thiophen-3-ylethanamine |
|---|---|
| PubChem CID | 110222149 |
| Molecular Formula | C22H23N3S |
| Molecular Weight | 361.51 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | N-[(1-methylindol-3-yl)methyl]-1-(5-methyl-2-pyridinyl)-2-thiophen-3-ylethanamine |
| SMILES | Cc1ccc(C(Cc2ccsc2)NCc2cn(C)c3ccccc23)nc1 |
| InChI | InChI=1S/C22H23N3S/c1-16-7-8-20(23-12-16)21(11-17-9-10-26-15-17)24-13-18-14-25(2)22-6-4-3-5-19(18)22/h3-10,12,14-15,21,24H,11,13H2,1-2H3 |
| InChIKey | DXWMBMCGUPLGHH-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.51 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |