C17H26O3 — CID 11022245
ethyl (1R,8R,8aR)-8-hydroxy-2,5,5,8a-tetramethyl-1,6,7,8-tetrahydronaphthalene-1-carboxylate (PubChem CID 11022245) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is ethyl (1R,8R,8aR)-8-hydroxy-2,5,5,8a-tetramethyl-1,6,7,8-tetrahydronaphthalene-1-carboxylate.
| Compound Name | ethyl (1R,8R,8aR)-8-hydroxy-2,5,5,8a-tetramethyl-1,6,7,8-tetrahydronaphthalene-1-carboxylate |
|---|---|
| PubChem CID | 11022245 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | ethyl (1R,8R,8aR)-8-hydroxy-2,5,5,8a-tetramethyl-1,6,7,8-tetrahydronaphthalene-1-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C(C)=CC=C2C(C)(C)CC[C@@H](O)[C@@]21C |
| InChI | InChI=1S/C17H26O3/c1-6-20-15(19)14-11(2)7-8-12-16(3,4)10-9-13(18)17(12,14)5/h7-8,13-14,18H,6,9-10H2,1-5H3/t13-,14+,17-/m1/s1 |
| InChIKey | VCGQJHANMZLAQH-JKIFEVAISA-N |
| XLogP | 3.24 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |