About 4-[[2-(2,4-dimethylphenyl)phenyl]methyl]-N-(oxan-3-ylmethyl)oxane-4-carboxamide
4-[[2-(2,4-dimethylphenyl)phenyl]methyl]-N-(oxan-3-ylmethyl)oxane-4-carboxamide (PubChem CID 110222681) has the molecular formula C27H35NO3
and a molecular weight of 421.58 g/mol. Its IUPAC name is 4-[[2-(2,4-dimethylphenyl)phenyl]methyl]-N-(oxan-3-ylmethyl)oxane-4-carboxamide.
Molecular Properties
| Compound Name | 4-[[2-(2,4-dimethylphenyl)phenyl]methyl]-N-(oxan-3-ylmethyl)oxane-4-carboxamide |
| PubChem CID | 110222681 |
| Molecular Formula | C27H35NO3 |
| Molecular Weight | 421.58 g/mol |
| Exact Mass | 421.26 |
| IUPAC Name | 4-[[2-(2,4-dimethylphenyl)phenyl]methyl]-N-(oxan-3-ylmethyl)oxane-4-carboxamide |
| SMILES | Cc1ccc(-c2ccccc2CC2(C(=O)NCC3CCCOC3)CCOCC2)c(C)c1 |
| InChI | InChI=1S/C27H35NO3/c1-20-9-10-24(21(2)16-20)25-8-4-3-7-23(25)17-27(11-14-30-15-12-27)26(29)28-18-22-6-5-13-31-19-22/h3-4,7-10,16,22H,5-6,11-15,17-19H2,1-2H3,(H,28,29) |
| InChIKey | STLHWGPQFTUIJT-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 421.58 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[[2-(2,4-dimethylphenyl)phenyl]methyl]-N-(oxan-3-ylmethyl)oxane-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[2-(2,4-dimethylphenyl)phenyl]methyl]-N-(oxan-3-ylmethyl)oxane-4-carboxamide?
The IUPAC name of 4-[[2-(2,4-dimethylphenyl)phenyl]methyl]-N-(oxan-3-ylmethyl)oxane-4-carboxamide (CID 110222681) is 4-[[2-(2,4-dimethylphenyl)phenyl]methyl]-N-(oxan-3-ylmethyl)oxane-4-carboxamide.
What is the SMILES notation for 4-[[2-(2,4-dimethylphenyl)phenyl]methyl]-N-(oxan-3-ylmethyl)oxane-4-carboxamide?
The canonical SMILES for 4-[[2-(2,4-dimethylphenyl)phenyl]methyl]-N-(oxan-3-ylmethyl)oxane-4-carboxamide is Cc1ccc(-c2ccccc2CC2(C(=O)NCC3CCCOC3)CCOCC2)c(C)c1.
What is the InChIKey of 4-[[2-(2,4-dimethylphenyl)phenyl]methyl]-N-(oxan-3-ylmethyl)oxane-4-carboxamide?
The InChIKey is STLHWGPQFTUIJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H35NO3/c1-20-9-10-24(21(2)16-20)25-8-4-3-7-23(25)17-27(11-14-30-15-12-27)26(29)28-18-22-6-5-13-31-19-22/h3-4,7-10,16,22H,5-6,11-15,17-19H2,1-2H3,(H,28,29).
What are the key properties of 4-[[2-(2,4-dimethylphenyl)phenyl]methyl]-N-(oxan-3-ylmethyl)oxane-4-carboxamide?
4-[[2-(2,4-dimethylphenyl)phenyl]methyl]-N-(oxan-3-ylmethyl)oxane-4-carboxamide has a molecular weight of 421.58 g/mol, XLogP of 4.85, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[2-(2,4-dimethylphenyl)phenyl]methyl]-N-(oxan-3-ylmethyl)oxane-4-carboxamide is sourced from PubChem (CID 110222681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).