About 4-[[2-(2,4-dimethylphenyl)phenyl]methyl]-N-(1-methylpiperidin-4-yl)oxane-4-carboxamide
4-[[2-(2,4-dimethylphenyl)phenyl]methyl]-N-(1-methylpiperidin-4-yl)oxane-4-carboxamide (PubChem CID 92556110) has the molecular formula C27H36N2O2
and a molecular weight of 420.60 g/mol. Its IUPAC name is 4-[[2-(2,4-dimethylphenyl)phenyl]methyl]-N-(1-methylpiperidin-4-yl)oxane-4-carboxamide.
Molecular Properties
| Compound Name | 4-[[2-(2,4-dimethylphenyl)phenyl]methyl]-N-(1-methylpiperidin-4-yl)oxane-4-carboxamide |
| PubChem CID | 92556110 |
| Molecular Formula | C27H36N2O2 |
| Molecular Weight | 420.60 g/mol |
| Exact Mass | 420.28 |
| IUPAC Name | 4-[[2-(2,4-dimethylphenyl)phenyl]methyl]-N-(1-methylpiperidin-4-yl)oxane-4-carboxamide |
| SMILES | Cc1ccc(-c2ccccc2CC2(C(=O)NC3CCN(C)CC3)CCOCC2)c(C)c1 |
| InChI | InChI=1S/C27H36N2O2/c1-20-8-9-24(21(2)18-20)25-7-5-4-6-22(25)19-27(12-16-31-17-13-27)26(30)28-23-10-14-29(3)15-11-23/h4-9,18,23H,10-17,19H2,1-3H3,(H,28,30) |
| InChIKey | CKZSKTABDOJKAX-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 420.60 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[[2-(2,4-dimethylphenyl)phenyl]methyl]-N-(1-methylpiperidin-4-yl)oxane-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[2-(2,4-dimethylphenyl)phenyl]methyl]-N-(1-methylpiperidin-4-yl)oxane-4-carboxamide?
The IUPAC name of 4-[[2-(2,4-dimethylphenyl)phenyl]methyl]-N-(1-methylpiperidin-4-yl)oxane-4-carboxamide (CID 92556110) is 4-[[2-(2,4-dimethylphenyl)phenyl]methyl]-N-(1-methylpiperidin-4-yl)oxane-4-carboxamide.
What is the SMILES notation for 4-[[2-(2,4-dimethylphenyl)phenyl]methyl]-N-(1-methylpiperidin-4-yl)oxane-4-carboxamide?
The canonical SMILES for 4-[[2-(2,4-dimethylphenyl)phenyl]methyl]-N-(1-methylpiperidin-4-yl)oxane-4-carboxamide is Cc1ccc(-c2ccccc2CC2(C(=O)NC3CCN(C)CC3)CCOCC2)c(C)c1.
What is the InChIKey of 4-[[2-(2,4-dimethylphenyl)phenyl]methyl]-N-(1-methylpiperidin-4-yl)oxane-4-carboxamide?
The InChIKey is CKZSKTABDOJKAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H36N2O2/c1-20-8-9-24(21(2)18-20)25-7-5-4-6-22(25)19-27(12-16-31-17-13-27)26(30)28-23-10-14-29(3)15-11-23/h4-9,18,23H,10-17,19H2,1-3H3,(H,28,30).
What are the key properties of 4-[[2-(2,4-dimethylphenyl)phenyl]methyl]-N-(1-methylpiperidin-4-yl)oxane-4-carboxamide?
4-[[2-(2,4-dimethylphenyl)phenyl]methyl]-N-(1-methylpiperidin-4-yl)oxane-4-carboxamide has a molecular weight of 420.60 g/mol, XLogP of 4.52, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[2-(2,4-dimethylphenyl)phenyl]methyl]-N-(1-methylpiperidin-4-yl)oxane-4-carboxamide is sourced from PubChem (CID 92556110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).