C15H22O5 — CID 11022361
(1R,3S,8R,11S,13R,17S)-2,7,12,16-tetraoxatetracyclo[9.8.0.03,8.013,17]nonadecan-15-one (PubChem CID 11022361) has the molecular formula C15H22O5 and a molecular weight of 282.34 g/mol. Its IUPAC name is (1R,3S,8R,11S,13R,17S)-2,7,12,16-tetraoxatetracyclo[9.8.0.03,8.013,17]nonadecan-15-one.
| Compound Name | (1R,3S,8R,11S,13R,17S)-2,7,12,16-tetraoxatetracyclo[9.8.0.03,8.013,17]nonadecan-15-one |
|---|---|
| PubChem CID | 11022361 |
| Molecular Formula | C15H22O5 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | (1R,3S,8R,11S,13R,17S)-2,7,12,16-tetraoxatetracyclo[9.8.0.03,8.013,17]nonadecan-15-one |
| SMILES | O=C1C[C@H]2O[C@H]3CC[C@H]4OCCC[C@@H]4O[C@@H]3CC[C@@H]2O1 |
| InChI | InChI=1S/C15H22O5/c16-15-8-14-13(20-15)6-5-11-12(19-14)4-3-9-10(18-11)2-1-7-17-9/h9-14H,1-8H2/t9-,10+,11-,12+,13+,14-/m1/s1 |
| InChIKey | PUOFQAXSQDVBMS-QTJJRWQNSA-N |
| XLogP | 1.58 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |