C10H7Cl4N — CID 11022385
(1Z)-4-methyl-N-(1,2,2-trichloroethenyl)benzenecarboximidoyl chloride (PubChem CID 11022385) has the molecular formula C10H7Cl4N and a molecular weight of 282.99 g/mol. Its IUPAC name is (1Z)-4-methyl-N-(1,2,2-trichloroethenyl)benzenecarboximidoyl chloride.
| Compound Name | (1Z)-4-methyl-N-(1,2,2-trichloroethenyl)benzenecarboximidoyl chloride |
|---|---|
| PubChem CID | 11022385 |
| Molecular Formula | C10H7Cl4N |
| Molecular Weight | 282.99 g/mol |
| Exact Mass | 280.93 |
| IUPAC Name | (1Z)-4-methyl-N-(1,2,2-trichloroethenyl)benzenecarboximidoyl chloride |
| SMILES | Cc1ccc(/C(Cl)=N/C(Cl)=C(Cl)Cl)cc1 |
| InChI | InChI=1S/C10H7Cl4N/c1-6-2-4-7(5-3-6)9(13)15-10(14)8(11)12/h2-5H,1H3/b15-9- |
| InChIKey | OOODVXGWLKSZFG-DHDCSXOGSA-N |
| XLogP | 4.82 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.99 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|