C17H11Cl3N2S2 — CID 3816702
1,3-benzothiazol-2-yl 4-methyl-N-(1,2,2-trichloroethenyl)benzenecarboximidothioate (PubChem CID 3816702) has the molecular formula C17H11Cl3N2S2 and a molecular weight of 413.78 g/mol. Its IUPAC name is 1,3-benzothiazol-2-yl 4-methyl-N-(1,2,2-trichloroethenyl)benzenecarboximidothioate.
| Compound Name | 1,3-benzothiazol-2-yl 4-methyl-N-(1,2,2-trichloroethenyl)benzenecarboximidothioate |
|---|---|
| PubChem CID | 3816702 |
| Molecular Formula | C17H11Cl3N2S2 |
| Molecular Weight | 413.78 g/mol |
| Exact Mass | 411.94 |
| IUPAC Name | 1,3-benzothiazol-2-yl 4-methyl-N-(1,2,2-trichloroethenyl)benzenecarboximidothioate |
| SMILES | Cc1ccc(C(=NC(Cl)=C(Cl)Cl)Sc2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C17H11Cl3N2S2/c1-10-6-8-11(9-7-10)16(22-15(20)14(18)19)24-17-21-12-4-2-3-5-13(12)23-17/h2-9H,1H3 |
| InChIKey | AHSJRXZPGDPVAP-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.78 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|