C12H15BrO3 — CID 11022511
(1S,3R,6R,7S,10R)-8-bromo-3-methoxy-1,10-dimethyl-4-oxatricyclo[4.3.1.03,7]dec-8-en-2-one (PubChem CID 11022511) has the molecular formula C12H15BrO3 and a molecular weight of 287.15 g/mol. Its IUPAC name is (1S,3R,6R,7S,10R)-8-bromo-3-methoxy-1,10-dimethyl-4-oxatricyclo[4.3.1.03,7]dec-8-en-2-one.
| Compound Name | (1S,3R,6R,7S,10R)-8-bromo-3-methoxy-1,10-dimethyl-4-oxatricyclo[4.3.1.03,7]dec-8-en-2-one |
|---|---|
| PubChem CID | 11022511 |
| Molecular Formula | C12H15BrO3 |
| Molecular Weight | 287.15 g/mol |
| Exact Mass | 286.02 |
| IUPAC Name | (1S,3R,6R,7S,10R)-8-bromo-3-methoxy-1,10-dimethyl-4-oxatricyclo[4.3.1.03,7]dec-8-en-2-one |
| SMILES | CO[C@@]12OC[C@@H]3[C@@H](C)[C@@](C)(C=C(Br)[C@@H]31)C2=O |
| InChI | InChI=1S/C12H15BrO3/c1-6-7-5-16-12(15-3)9(7)8(13)4-11(6,2)10(12)14/h4,6-7,9H,5H2,1-3H3/t6-,7-,9-,11-,12-/m1/s1 |
| InChIKey | XUFJZBUAJPIQFN-ULOGXBKZSA-N |
| XLogP | 2.11 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.15 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |