C16H18O5 — CID 11022602
(1R,2S,4S,7R,9S,10S)-10-methyl-4-phenyl-3,5,8,13-tetraoxatricyclo[7.4.0.02,7]tridecan-11-one (PubChem CID 11022602) has the molecular formula C16H18O5 and a molecular weight of 290.31 g/mol. Its IUPAC name is (1R,2S,4S,7R,9S,10S)-10-methyl-4-phenyl-3,5,8,13-tetraoxatricyclo[7.4.0.02,7]tridecan-11-one.
| Compound Name | (1R,2S,4S,7R,9S,10S)-10-methyl-4-phenyl-3,5,8,13-tetraoxatricyclo[7.4.0.02,7]tridecan-11-one |
|---|---|
| PubChem CID | 11022602 |
| Molecular Formula | C16H18O5 |
| Molecular Weight | 290.31 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | (1R,2S,4S,7R,9S,10S)-10-methyl-4-phenyl-3,5,8,13-tetraoxatricyclo[7.4.0.02,7]tridecan-11-one |
| SMILES | C[C@@H]1C(=O)CO[C@@H]2[C@H]1O[C@@H]1CO[C@H](c3ccccc3)O[C@H]21 |
| InChI | InChI=1S/C16H18O5/c1-9-11(17)7-18-15-13(9)20-12-8-19-16(21-14(12)15)10-5-3-2-4-6-10/h2-6,9,12-16H,7-8H2,1H3/t9-,12-,13+,14+,15-,16+/m1/s1 |
| InChIKey | IZGTVNHJGWITGJ-XODNIXLUSA-N |
| XLogP | 1.47 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.31 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |