C14H11N5OS — CID 11022869
14-methoxy-6-methyl-2-thia-4,5,7,8,18-pentazatetracyclo[8.8.0.03,7.012,17]octadeca-1(10),3,5,8,11,13,15,17-octaene (PubChem CID 11022869) has the molecular formula C14H11N5OS and a molecular weight of 297.34 g/mol. Its IUPAC name is 14-methoxy-6-methyl-2-thia-4,5,7,8,18-pentazatetracyclo[8.8.0.03,7.012,17]octadeca-1(10),3,5,8,11,13,15,17-octaene.
| Compound Name | 14-methoxy-6-methyl-2-thia-4,5,7,8,18-pentazatetracyclo[8.8.0.03,7.012,17]octadeca-1(10),3,5,8,11,13,15,17-octaene |
|---|---|
| PubChem CID | 11022869 |
| Molecular Formula | C14H11N5OS |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | 14-methoxy-6-methyl-2-thia-4,5,7,8,18-pentazatetracyclo[8.8.0.03,7.012,17]octadeca-1(10),3,5,8,11,13,15,17-octaene |
| SMILES | COc1ccc2nc3c(cc2c1)C=Nn1c(C)nnc1S3 |
| InChI | InChI=1S/C14H11N5OS/c1-8-17-18-14-19(8)15-7-10-5-9-6-11(20-2)3-4-12(9)16-13(10)21-14/h3-7H,1-2H3 |
| InChIKey | GYYJSINMMMIJRZ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 65.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |