C13H14N2O — CID 82471113
8-methoxy-1,2,3,4-tetrahydrobenzo[b][1,6]naphthyridine (PubChem CID 82471113) has the molecular formula C13H14N2O and a molecular weight of 214.27 g/mol. Its IUPAC name is 8-methoxy-1,2,3,4-tetrahydrobenzo[b][1,6]naphthyridine.
| Compound Name | 8-methoxy-1,2,3,4-tetrahydrobenzo[b][1,6]naphthyridine |
|---|---|
| PubChem CID | 82471113 |
| Molecular Formula | C13H14N2O |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | 8-methoxy-1,2,3,4-tetrahydrobenzo[b][1,6]naphthyridine |
| SMILES | COc1ccc2nc3c(cc2c1)CNCC3 |
| InChI | InChI=1S/C13H14N2O/c1-16-11-2-3-12-9(7-11)6-10-8-14-5-4-13(10)15-12/h2-3,6-7,14H,4-5,8H2,1H3 |
| InChIKey | KACFEGPLZFAICO-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |