C17H13N5O2 — CID 11023597
methyl 4-[diazo-(3-phenyl-1H-1,2,4-triazol-5-yl)methyl]benzoate (PubChem CID 11023597) has the molecular formula C17H13N5O2 and a molecular weight of 319.32 g/mol. Its IUPAC name is methyl 4-[diazo-(3-phenyl-1H-1,2,4-triazol-5-yl)methyl]benzoate.
| Compound Name | methyl 4-[diazo-(3-phenyl-1H-1,2,4-triazol-5-yl)methyl]benzoate |
|---|---|
| PubChem CID | 11023597 |
| Molecular Formula | C17H13N5O2 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | methyl 4-[diazo-(3-phenyl-1H-1,2,4-triazol-5-yl)methyl]benzoate |
| SMILES | COC(=O)c1ccc(C(=[N+]=[N-])c2nc(-c3ccccc3)n[nH]2)cc1 |
| InChI | InChI=1S/C17H13N5O2/c1-24-17(23)13-9-7-11(8-10-13)14(20-18)16-19-15(21-22-16)12-5-3-2-4-6-12/h2-10H,1H3,(H,19,21,22) |
| InChIKey | JHCAJXDXGDESLH-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 104.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|