C24H27NO6 — CID 110236920
2-[1-(3,4,5-trimethoxybenzoyl)piperidin-3-yl]-2,3-dihydrochromen-4-one (PubChem CID 110236920) has the molecular formula C24H27NO6 and a molecular weight of 425.48 g/mol. Its IUPAC name is 2-[1-(3,4,5-trimethoxybenzoyl)piperidin-3-yl]-2,3-dihydrochromen-4-one.
| Compound Name | 2-[1-(3,4,5-trimethoxybenzoyl)piperidin-3-yl]-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 110236920 |
| Molecular Formula | C24H27NO6 |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | 2-[1-(3,4,5-trimethoxybenzoyl)piperidin-3-yl]-2,3-dihydrochromen-4-one |
| SMILES | COc1cc(C(=O)N2CCCC(C3CC(=O)c4ccccc4O3)C2)cc(OC)c1OC |
| InChI | InChI=1S/C24H27NO6/c1-28-21-11-16(12-22(29-2)23(21)30-3)24(27)25-10-6-7-15(14-25)20-13-18(26)17-8-4-5-9-19(17)31-20/h4-5,8-9,11-12,15,20H,6-7,10,13-14H2,1-3H3 |
| InChIKey | PHKVCCDZDCESJZ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |