C19H23N5O2S — CID 110237469
12-[3-(3,5-dimethylpyrazol-1-yl)butanoyl]-6-thia-1,8,12-triazatricyclo[7.5.0.03,7]tetradeca-3(7),4,8-trien-2-one (PubChem CID 110237469) has the molecular formula C19H23N5O2S and a molecular weight of 385.49 g/mol. Its IUPAC name is 12-[3-(3,5-dimethylpyrazol-1-yl)butanoyl]-6-thia-1,8,12-triazatricyclo[7.5.0.03,7]tetradeca-3(7),4,8-trien-2-one.
| Compound Name | 12-[3-(3,5-dimethylpyrazol-1-yl)butanoyl]-6-thia-1,8,12-triazatricyclo[7.5.0.03,7]tetradeca-3(7),4,8-trien-2-one |
|---|---|
| PubChem CID | 110237469 |
| Molecular Formula | C19H23N5O2S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | 12-[3-(3,5-dimethylpyrazol-1-yl)butanoyl]-6-thia-1,8,12-triazatricyclo[7.5.0.03,7]tetradeca-3(7),4,8-trien-2-one |
| SMILES | Cc1cc(C)n(C(C)CC(=O)N2CCc3nc4sccc4c(=O)n3CC2)n1 |
| InChI | InChI=1S/C19H23N5O2S/c1-12-10-13(2)24(21-12)14(3)11-17(25)22-6-4-16-20-18-15(5-9-27-18)19(26)23(16)8-7-22/h5,9-10,14H,4,6-8,11H2,1-3H3 |
| InChIKey | YFIVPRMZQGFDRX-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 73.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |