C16H19N5OS — CID 92606752
12-[(1,3-dimethylpyrazol-4-yl)methyl]-6-thia-1,8,12-triazatricyclo[7.5.0.03,7]tetradeca-3(7),4,8-trien-2-one (PubChem CID 92606752) has the molecular formula C16H19N5OS and a molecular weight of 329.43 g/mol. Its IUPAC name is 12-[(1,3-dimethylpyrazol-4-yl)methyl]-6-thia-1,8,12-triazatricyclo[7.5.0.03,7]tetradeca-3(7),4,8-trien-2-one.
| Compound Name | 12-[(1,3-dimethylpyrazol-4-yl)methyl]-6-thia-1,8,12-triazatricyclo[7.5.0.03,7]tetradeca-3(7),4,8-trien-2-one |
|---|---|
| PubChem CID | 92606752 |
| Molecular Formula | C16H19N5OS |
| Molecular Weight | 329.43 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | 12-[(1,3-dimethylpyrazol-4-yl)methyl]-6-thia-1,8,12-triazatricyclo[7.5.0.03,7]tetradeca-3(7),4,8-trien-2-one |
| SMILES | Cc1nn(C)cc1CN1CCc2nc3sccc3c(=O)n2CC1 |
| InChI | InChI=1S/C16H19N5OS/c1-11-12(9-19(2)18-11)10-20-5-3-14-17-15-13(4-8-23-15)16(22)21(14)7-6-20/h4,8-9H,3,5-7,10H2,1-2H3 |
| InChIKey | AUBCTHJNYNVKND-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 55.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.43 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |