C22H24N4O2 — CID 110240767
(3,5-dimethyl-1-benzofuran-2-yl)-[2-(5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-2-yl)pyrrolidin-1-yl]methanone (PubChem CID 110240767) has the molecular formula C22H24N4O2 and a molecular weight of 376.46 g/mol. Its IUPAC name is (3,5-dimethyl-1-benzofuran-2-yl)-[2-(5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-2-yl)pyrrolidin-1-yl]methanone.
| Compound Name | (3,5-dimethyl-1-benzofuran-2-yl)-[2-(5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-2-yl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 110240767 |
| Molecular Formula | C22H24N4O2 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | (3,5-dimethyl-1-benzofuran-2-yl)-[2-(5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-2-yl)pyrrolidin-1-yl]methanone |
| SMILES | Cc1ccc2oc(C(=O)N3CCCC3c3ncc4c(n3)CCNC4)c(C)c2c1 |
| InChI | InChI=1S/C22H24N4O2/c1-13-5-6-19-16(10-13)14(2)20(28-19)22(27)26-9-3-4-18(26)21-24-12-15-11-23-8-7-17(15)25-21/h5-6,10,12,18,23H,3-4,7-9,11H2,1-2H3 |
| InChIKey | QJTXXGKFQOHJCG-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |