C22H26N4O — CID 92571763
5,6,7,8-tetrahydronaphthalen-2-yl-[(2S)-2-(5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-2-yl)pyrrolidin-1-yl]methanone (PubChem CID 92571763) has the molecular formula C22H26N4O and a molecular weight of 362.48 g/mol. Its IUPAC name is 5,6,7,8-tetrahydronaphthalen-2-yl-[(2S)-2-(5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-2-yl)pyrrolidin-1-yl]methanone.
| Compound Name | 5,6,7,8-tetrahydronaphthalen-2-yl-[(2S)-2-(5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-2-yl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 92571763 |
| Molecular Formula | C22H26N4O |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | 5,6,7,8-tetrahydronaphthalen-2-yl-[(2S)-2-(5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-2-yl)pyrrolidin-1-yl]methanone |
| SMILES | O=C(c1ccc2c(c1)CCCC2)N1CCC[C@H]1c1ncc2c(n1)CCNC2 |
| InChI | InChI=1S/C22H26N4O/c27-22(17-8-7-15-4-1-2-5-16(15)12-17)26-11-3-6-20(26)21-24-14-18-13-23-10-9-19(18)25-21/h7-8,12,14,20,23H,1-6,9-11,13H2/t20-/m0/s1 |
| InChIKey | KNQDNGBHIALFAJ-FQEVSTJZSA-N |
| XLogP | 2.98 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |