C22H25N5O — CID 92560246
(1,5-dimethylindol-2-yl)-[(2R)-2-(5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-2-yl)pyrrolidin-1-yl]methanone (PubChem CID 92560246) has the molecular formula C22H25N5O and a molecular weight of 375.48 g/mol. Its IUPAC name is (1,5-dimethylindol-2-yl)-[(2R)-2-(5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-2-yl)pyrrolidin-1-yl]methanone.
| Compound Name | (1,5-dimethylindol-2-yl)-[(2R)-2-(5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-2-yl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 92560246 |
| Molecular Formula | C22H25N5O |
| Molecular Weight | 375.48 g/mol |
| Exact Mass | 375.21 |
| IUPAC Name | (1,5-dimethylindol-2-yl)-[(2R)-2-(5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-2-yl)pyrrolidin-1-yl]methanone |
| SMILES | Cc1ccc2c(c1)cc(C(=O)N1CCC[C@@H]1c1ncc3c(n1)CCNC3)n2C |
| InChI | InChI=1S/C22H25N5O/c1-14-5-6-18-15(10-14)11-20(26(18)2)22(28)27-9-3-4-19(27)21-24-13-16-12-23-8-7-17(16)25-21/h5-6,10-11,13,19,23H,3-4,7-9,12H2,1-2H3/t19-/m1/s1 |
| InChIKey | DCQDDINRGKPDJD-LJQANCHMSA-N |
| XLogP | 2.90 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.48 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |