C20H40O4Si — CID 11025129
[(3S,4R)-4-methyl-5-oxoheptan-3-yl] (2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methylpentanoate (PubChem CID 11025129) has the molecular formula C20H40O4Si and a molecular weight of 372.62 g/mol. Its IUPAC name is [(3S,4R)-4-methyl-5-oxoheptan-3-yl] (2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methylpentanoate.
| Compound Name | [(3S,4R)-4-methyl-5-oxoheptan-3-yl] (2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methylpentanoate |
|---|---|
| PubChem CID | 11025129 |
| Molecular Formula | C20H40O4Si |
| Molecular Weight | 372.62 g/mol |
| Exact Mass | 372.27 |
| IUPAC Name | [(3S,4R)-4-methyl-5-oxoheptan-3-yl] (2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methylpentanoate |
| SMILES | CCC(=O)[C@H](C)[C@H](CC)OC(=O)[C@@H](C)[C@H](CC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H40O4Si/c1-11-16(21)14(4)17(12-2)23-19(22)15(5)18(13-3)24-25(9,10)20(6,7)8/h14-15,17-18H,11-13H2,1-10H3/t14-,15-,17-,18-/m0/s1 |
| InChIKey | MYCPMGQMHBVCMW-LAQRGFTBSA-N |
| XLogP | 5.36 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.62 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|