C23H30N4O3 — CID 110252786
1-[2-[1-(5-methyl-1H-pyrazole-4-carbonyl)piperidin-4-yl]piperidin-1-yl]-2-phenoxyethanone (PubChem CID 110252786) has the molecular formula C23H30N4O3 and a molecular weight of 410.52 g/mol. Its IUPAC name is 1-[2-[1-(5-methyl-1H-pyrazole-4-carbonyl)piperidin-4-yl]piperidin-1-yl]-2-phenoxyethanone.
| Compound Name | 1-[2-[1-(5-methyl-1H-pyrazole-4-carbonyl)piperidin-4-yl]piperidin-1-yl]-2-phenoxyethanone |
|---|---|
| PubChem CID | 110252786 |
| Molecular Formula | C23H30N4O3 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | 1-[2-[1-(5-methyl-1H-pyrazole-4-carbonyl)piperidin-4-yl]piperidin-1-yl]-2-phenoxyethanone |
| SMILES | Cc1[nH]ncc1C(=O)N1CCC(C2CCCCN2C(=O)COc2ccccc2)CC1 |
| InChI | InChI=1S/C23H30N4O3/c1-17-20(15-24-25-17)23(29)26-13-10-18(11-14-26)21-9-5-6-12-27(21)22(28)16-30-19-7-3-2-4-8-19/h2-4,7-8,15,18,21H,5-6,9-14,16H2,1H3,(H,24,25) |
| InChIKey | CPKBAWMDVGPTIT-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 78.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |