C26H25NO3 — CID 11025757
(3S,4S)-3-acetyl-1-benzyl-4-[methoxy(diphenyl)methyl]azetidin-2-one (PubChem CID 11025757) has the molecular formula C26H25NO3 and a molecular weight of 399.49 g/mol. Its IUPAC name is (3S,4S)-3-acetyl-1-benzyl-4-[methoxy(diphenyl)methyl]azetidin-2-one.
| Compound Name | (3S,4S)-3-acetyl-1-benzyl-4-[methoxy(diphenyl)methyl]azetidin-2-one |
|---|---|
| PubChem CID | 11025757 |
| Molecular Formula | C26H25NO3 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | (3S,4S)-3-acetyl-1-benzyl-4-[methoxy(diphenyl)methyl]azetidin-2-one |
| SMILES | COC(c1ccccc1)(c1ccccc1)[C@@H]1[C@@H](C(C)=O)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C26H25NO3/c1-19(28)23-24(27(25(23)29)18-20-12-6-3-7-13-20)26(30-2,21-14-8-4-9-15-21)22-16-10-5-11-17-22/h3-17,23-24H,18H2,1-2H3/t23-,24+/m1/s1 |
| InChIKey | XFXBMSDOSIXVTI-RPWUZVMVSA-N |
| XLogP | 4.19 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|