C13H20N4O3S — CID 110257937
N-methyl-3-[5-(1-methylsulfonylpyrrolidin-2-yl)pyrazin-2-yl]propanamide (PubChem CID 110257937) has the molecular formula C13H20N4O3S and a molecular weight of 312.40 g/mol. Its IUPAC name is N-methyl-3-[5-(1-methylsulfonylpyrrolidin-2-yl)pyrazin-2-yl]propanamide.
| Compound Name | N-methyl-3-[5-(1-methylsulfonylpyrrolidin-2-yl)pyrazin-2-yl]propanamide |
|---|---|
| PubChem CID | 110257937 |
| Molecular Formula | C13H20N4O3S |
| Molecular Weight | 312.40 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | N-methyl-3-[5-(1-methylsulfonylpyrrolidin-2-yl)pyrazin-2-yl]propanamide |
| SMILES | CNC(=O)CCc1cnc(C2CCCN2S(C)(=O)=O)cn1 |
| InChI | InChI=1S/C13H20N4O3S/c1-14-13(18)6-5-10-8-16-11(9-15-10)12-4-3-7-17(12)21(2,19)20/h8-9,12H,3-7H2,1-2H3,(H,14,18) |
| InChIKey | MYCWVZBNRGKANC-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.40 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |