C20H23N5OS — CID 110260331
N-[4-(3-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)phenyl]-2,4-dimethyl-1,3-thiazole-5-carboxamide (PubChem CID 110260331) has the molecular formula C20H23N5OS and a molecular weight of 381.51 g/mol. Its IUPAC name is N-[4-(3-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)phenyl]-2,4-dimethyl-1,3-thiazole-5-carboxamide.
| Compound Name | N-[4-(3-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)phenyl]-2,4-dimethyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 110260331 |
| Molecular Formula | C20H23N5OS |
| Molecular Weight | 381.51 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | N-[4-(3-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl)phenyl]-2,4-dimethyl-1,3-thiazole-5-carboxamide |
| SMILES | CCc1nnc2n1CC(c1ccc(NC(=O)c3sc(C)nc3C)cc1)CC2 |
| InChI | InChI=1S/C20H23N5OS/c1-4-17-23-24-18-10-7-15(11-25(17)18)14-5-8-16(9-6-14)22-20(26)19-12(2)21-13(3)27-19/h5-6,8-9,15H,4,7,10-11H2,1-3H3,(H,22,26) |
| InChIKey | PSJFLVVNCGIYOY-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.51 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |