C20H40O5Si2 — CID 11026122
ethyl (E,4R,5S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-oxohex-2-enoate (PubChem CID 11026122) has the molecular formula C20H40O5Si2 and a molecular weight of 416.71 g/mol. Its IUPAC name is ethyl (E,4R,5S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-oxohex-2-enoate.
| Compound Name | ethyl (E,4R,5S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-oxohex-2-enoate |
|---|---|
| PubChem CID | 11026122 |
| Molecular Formula | C20H40O5Si2 |
| Molecular Weight | 416.71 g/mol |
| Exact Mass | 416.24 |
| IUPAC Name | ethyl (E,4R,5S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-oxohex-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H40O5Si2/c1-12-23-18(22)14-13-16(24-26(8,9)19(2,3)4)17(15-21)25-27(10,11)20(5,6)7/h13-17H,12H2,1-11H3/b14-13+/t16-,17-/m1/s1 |
| InChIKey | NVKHQXUKTCEZMF-UEWLMQCVSA-N |
| XLogP | 5.09 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.71 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|