C22H23N3O4S — CID 11026284
2-(5,5,19-trimethyl-6-oxa-10,11,19-triazapentacyclo[10.7.1.02,7.09,20.013,18]icosa-1(20),2(7),3,8,11,13,15,17-octaen-10-yl)ethyl methanesulfonate (PubChem CID 11026284) has the molecular formula C22H23N3O4S and a molecular weight of 425.51 g/mol. Its IUPAC name is 2-(5,5,19-trimethyl-6-oxa-10,11,19-triazapentacyclo[10.7.1.02,7.09,20.013,18]icosa-1(20),2(7),3,8,11,13,15,17-octaen-10-yl)ethyl methanesulfonate.
| Compound Name | 2-(5,5,19-trimethyl-6-oxa-10,11,19-triazapentacyclo[10.7.1.02,7.09,20.013,18]icosa-1(20),2(7),3,8,11,13,15,17-octaen-10-yl)ethyl methanesulfonate |
|---|---|
| PubChem CID | 11026284 |
| Molecular Formula | C22H23N3O4S |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | 2-(5,5,19-trimethyl-6-oxa-10,11,19-triazapentacyclo[10.7.1.02,7.09,20.013,18]icosa-1(20),2(7),3,8,11,13,15,17-octaen-10-yl)ethyl methanesulfonate |
| SMILES | CN1c2ccccc2-c2nn(CCOS(C)(=O)=O)c3cc4c(c1c23)C=CC(C)(C)O4 |
| InChI | InChI=1S/C22H23N3O4S/c1-22(2)10-9-15-18(29-22)13-17-19-20(23-25(17)11-12-28-30(4,26)27)14-7-5-6-8-16(14)24(3)21(15)19/h5-10,13H,11-12H2,1-4H3 |
| InChIKey | LEAPXPHJXNGABH-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|