C23H25N3O5S — CID 11080950
2-(15-methoxy-5,5,19-trimethyl-6-oxa-10,11,19-triazapentacyclo[10.7.1.02,7.09,20.013,18]icosa-1(20),2(7),3,8,11,13(18),14,16-octaen-10-yl)ethyl methanesulfonate (PubChem CID 11080950) has the molecular formula C23H25N3O5S and a molecular weight of 455.54 g/mol. Its IUPAC name is 2-(15-methoxy-5,5,19-trimethyl-6-oxa-10,11,19-triazapentacyclo[10.7.1.02,7.09,20.013,18]icosa-1(20),2(7),3,8,11,13(18),14,16-octaen-10-yl)ethyl methanesulfonate.
| Compound Name | 2-(15-methoxy-5,5,19-trimethyl-6-oxa-10,11,19-triazapentacyclo[10.7.1.02,7.09,20.013,18]icosa-1(20),2(7),3,8,11,13(18),14,16-octaen-10-yl)ethyl methanesulfonate |
|---|---|
| PubChem CID | 11080950 |
| Molecular Formula | C23H25N3O5S |
| Molecular Weight | 455.54 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | 2-(15-methoxy-5,5,19-trimethyl-6-oxa-10,11,19-triazapentacyclo[10.7.1.02,7.09,20.013,18]icosa-1(20),2(7),3,8,11,13(18),14,16-octaen-10-yl)ethyl methanesulfonate |
| SMILES | COc1ccc2c(c1)-c1nn(CCOS(C)(=O)=O)c3cc4c(c(c13)N2C)C=CC(C)(C)O4 |
| InChI | InChI=1S/C23H25N3O5S/c1-23(2)9-8-15-19(31-23)13-18-20-21(24-26(18)10-11-30-32(5,27)28)16-12-14(29-4)6-7-17(16)25(3)22(15)20/h6-9,12-13H,10-11H2,1-5H3 |
| InChIKey | XTMHITCMJONOMS-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 82.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.54 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|