C27H31N3O2 — CID 11026367
1-[2-[(4-benzylpiperidin-1-yl)methyl]phenyl]-3-(3-methoxyphenyl)urea (PubChem CID 11026367) has the molecular formula C27H31N3O2 and a molecular weight of 429.56 g/mol. Its IUPAC name is 1-[2-[(4-benzylpiperidin-1-yl)methyl]phenyl]-3-(3-methoxyphenyl)urea.
| Compound Name | 1-[2-[(4-benzylpiperidin-1-yl)methyl]phenyl]-3-(3-methoxyphenyl)urea |
|---|---|
| PubChem CID | 11026367 |
| Molecular Formula | C27H31N3O2 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | 1-[2-[(4-benzylpiperidin-1-yl)methyl]phenyl]-3-(3-methoxyphenyl)urea |
| SMILES | COc1cccc(NC(=O)Nc2ccccc2CN2CCC(Cc3ccccc3)CC2)c1 |
| InChI | InChI=1S/C27H31N3O2/c1-32-25-12-7-11-24(19-25)28-27(31)29-26-13-6-5-10-23(26)20-30-16-14-22(15-17-30)18-21-8-3-2-4-9-21/h2-13,19,22H,14-18,20H2,1H3,(H2,28,29,31) |
| InChIKey | QTOZBBZMQKESRV-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |