C24H34FN3O3 — CID 25014954
1-(1-adamantyl)-3-[4-fluoro-3-(3-morpholin-4-ylpropoxy)phenyl]urea (PubChem CID 25014954) has the molecular formula C24H34FN3O3 and a molecular weight of 431.55 g/mol. Its IUPAC name is 1-(1-adamantyl)-3-[4-fluoro-3-(3-morpholin-4-ylpropoxy)phenyl]urea.
| Compound Name | 1-(1-adamantyl)-3-[4-fluoro-3-(3-morpholin-4-ylpropoxy)phenyl]urea |
|---|---|
| PubChem CID | 25014954 |
| Molecular Formula | C24H34FN3O3 |
| Molecular Weight | 431.55 g/mol |
| Exact Mass | 431.26 |
| IUPAC Name | 1-(1-adamantyl)-3-[4-fluoro-3-(3-morpholin-4-ylpropoxy)phenyl]urea |
| SMILES | O=C(Nc1ccc(F)c(OCCCN2CCOCC2)c1)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C24H34FN3O3/c25-21-3-2-20(13-22(21)31-7-1-4-28-5-8-30-9-6-28)26-23(29)27-24-14-17-10-18(15-24)12-19(11-17)16-24/h2-3,13,17-19H,1,4-12,14-16H2,(H2,26,27,29) |
| InChIKey | MIMKZWXNAZXTBL-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.55 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|