C21H20ClNO3 — CID 110274494
2-chloro-N-[(2-oxo-6-propan-2-ylchromen-4-yl)methyl]-2-phenylacetamide (PubChem CID 110274494) has the molecular formula C21H20ClNO3 and a molecular weight of 369.85 g/mol. Its IUPAC name is 2-chloro-N-[(2-oxo-6-propan-2-ylchromen-4-yl)methyl]-2-phenylacetamide.
| Compound Name | 2-chloro-N-[(2-oxo-6-propan-2-ylchromen-4-yl)methyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 110274494 |
| Molecular Formula | C21H20ClNO3 |
| Molecular Weight | 369.85 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | 2-chloro-N-[(2-oxo-6-propan-2-ylchromen-4-yl)methyl]-2-phenylacetamide |
| SMILES | CC(C)c1ccc2oc(=O)cc(CNC(=O)C(Cl)c3ccccc3)c2c1 |
| InChI | InChI=1S/C21H20ClNO3/c1-13(2)15-8-9-18-17(10-15)16(11-19(24)26-18)12-23-21(25)20(22)14-6-4-3-5-7-14/h3-11,13,20H,12H2,1-2H3,(H,23,25) |
| InChIKey | NUWTVHIEOAKAEF-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.85 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|